C22H20N2O3S — CID 90811725
4-[2-[4-[(3-phenoxyphenyl)methoxy]phenyl]ethyl]-3H-1,2,3,5-oxathiadiazole (PubChem CID 90811725) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-[2-[4-[(3-phenoxyphenyl)methoxy]phenyl]ethyl]-3H-1,2,3,5-oxathiadiazole.
| Compound Name | 4-[2-[4-[(3-phenoxyphenyl)methoxy]phenyl]ethyl]-3H-1,2,3,5-oxathiadiazole |
|---|---|
| PubChem CID | 90811725 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-[2-[4-[(3-phenoxyphenyl)methoxy]phenyl]ethyl]-3H-1,2,3,5-oxathiadiazole |
| SMILES | c1ccc(Oc2cccc(COc3ccc(CCC4=NOSN4)cc3)c2)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-2-6-20(7-3-1)26-21-8-4-5-18(15-21)16-25-19-12-9-17(10-13-19)11-14-22-23-27-28-24-22/h1-10,12-13,15H,11,14,16H2,(H,23,24) |
| InChIKey | YYCTYRPCJFLOFC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|