C27H23Cl2NO4 — CID 19831510
acetic acid;2,6-dichloro-N-[4-[(3-phenoxyphenyl)methoxy]phenyl]aniline (PubChem CID 19831510) has the molecular formula C27H23Cl2NO4 and a molecular weight of 496.39 g/mol. Its IUPAC name is acetic acid;2,6-dichloro-N-[4-[(3-phenoxyphenyl)methoxy]phenyl]aniline.
| Compound Name | acetic acid;2,6-dichloro-N-[4-[(3-phenoxyphenyl)methoxy]phenyl]aniline |
|---|---|
| PubChem CID | 19831510 |
| Molecular Formula | C27H23Cl2NO4 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | acetic acid;2,6-dichloro-N-[4-[(3-phenoxyphenyl)methoxy]phenyl]aniline |
| SMILES | CC(=O)O.Clc1cccc(Cl)c1Nc1ccc(OCc2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H19Cl2NO2.C2H4O2/c26-23-10-5-11-24(27)25(23)28-19-12-14-20(15-13-19)29-17-18-6-4-9-22(16-18)30-21-7-2-1-3-8-21;1-2(3)4/h1-16,28H,17H2;1H3,(H,3,4) |
| InChIKey | IOOQXXKINRGWNG-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |