C21H24F3NO5 — CID 23121351
3-[[3-[2-(3-methylphenyl)ethoxy]phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 23121351) has the molecular formula C21H24F3NO5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 3-[[3-[2-(3-methylphenyl)ethoxy]phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[3-[2-(3-methylphenyl)ethoxy]phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23121351 |
| Molecular Formula | C21H24F3NO5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 3-[[3-[2-(3-methylphenyl)ethoxy]phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cccc(CCOc2cccc(CNCCC(=O)O)c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23NO3.C2HF3O2/c1-15-4-2-5-16(12-15)9-11-23-18-7-3-6-17(13-18)14-20-10-8-19(21)22;3-2(4,5)1(6)7/h2-7,12-13,20H,8-11,14H2,1H3,(H,21,22);(H,6,7) |
| InChIKey | RJODRBSEAKZTFS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|