C27H30F3N3O3 — CID 151298465
3-[[4-[[(2S)-3-methyl-1-[4-[5-(trifluoromethyl)-2-pyridinyl]phenoxy]butan-2-yl]amino]phenyl]methylamino]propanoic acid (PubChem CID 151298465) has the molecular formula C27H30F3N3O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is 3-[[4-[[(2S)-3-methyl-1-[4-[5-(trifluoromethyl)-2-pyridinyl]phenoxy]butan-2-yl]amino]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[[(2S)-3-methyl-1-[4-[5-(trifluoromethyl)-2-pyridinyl]phenoxy]butan-2-yl]amino]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 151298465 |
| Molecular Formula | C27H30F3N3O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 3-[[4-[[(2S)-3-methyl-1-[4-[5-(trifluoromethyl)-2-pyridinyl]phenoxy]butan-2-yl]amino]phenyl]methylamino]propanoic acid |
| SMILES | CC(C)[C@@H](COc1ccc(-c2ccc(C(F)(F)F)cn2)cc1)Nc1ccc(CNCCC(=O)O)cc1 |
| InChI | InChI=1S/C27H30F3N3O3/c1-18(2)25(33-22-8-3-19(4-9-22)15-31-14-13-26(34)35)17-36-23-10-5-20(6-11-23)24-12-7-21(16-32-24)27(28,29)30/h3-12,16,18,25,31,33H,13-15,17H2,1-2H3,(H,34,35)/t25-/m1/s1 |
| InChIKey | OBXKPUKYKDABBY-RUZDIDTESA-N |
| XLogP | 5.85 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|