C18H20F3N3O7S2 — CID 166425113
3-[2-[[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166425113) has the molecular formula C18H20F3N3O7S2 and a molecular weight of 511.50 g/mol. Its IUPAC name is 3-[2-[[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166425113 |
| Molecular Formula | C18H20F3N3O7S2 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 3-[2-[[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COc2ccc(C(=O)NCCSSCCC(=O)O)cc2)no1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H19N3O5S2.C2HF3O2/c1-11-18-14(19-24-11)10-23-13-4-2-12(3-5-13)16(22)17-7-9-26-25-8-6-15(20)21;3-2(4,5)1(6)7/h2-5H,6-10H2,1H3,(H,17,22)(H,20,21);(H,6,7) |
| InChIKey | RAELGQLYAYMSBQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|