C25H31N5O3 — CID 55633954
N-[3-(4-benzylpiperazin-1-yl)propyl]-4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzamide (PubChem CID 55633954) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 55633954 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzamide |
| SMILES | Cc1nc(COc2ccc(C(=O)NCCCN3CCN(Cc4ccccc4)CC3)cc2)no1 |
| InChI | InChI=1S/C25H31N5O3/c1-20-27-24(28-33-20)19-32-23-10-8-22(9-11-23)25(31)26-12-5-13-29-14-16-30(17-15-29)18-21-6-3-2-4-7-21/h2-4,6-11H,5,12-19H2,1H3,(H,26,31) |
| InChIKey | TWFHEEIGVGMJJA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|