C21H29N3O3 — CID 31093025
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 31093025) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 31093025 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | Cc1noc(C)c1COc1ccc(C(=O)NCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C21H29N3O3/c1-16-20(17(2)27-23-16)15-26-19-9-7-18(8-10-19)21(25)22-11-6-14-24-12-4-3-5-13-24/h7-10H,3-6,11-15H2,1-2H3,(H,22,25) |
| InChIKey | GIDXZWUTXPXFGP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|