C22H31N3O3 — CID 9472943
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide (PubChem CID 9472943) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 9472943 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]benzamide |
| SMILES | Cc1noc(C)c1COc1cccc(C(=O)NCCCN2CCCC[C@@H]2C)c1 |
| InChI | InChI=1S/C22H31N3O3/c1-16-8-4-5-12-25(16)13-7-11-23-22(26)19-9-6-10-20(14-19)27-15-21-17(2)24-28-18(21)3/h6,9-10,14,16H,4-5,7-8,11-13,15H2,1-3H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | BXNVZWPIKRJIIG-INIZCTEOSA-N |
| XLogP | 3.86 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|