C19H23N3O4 — CID 32969083
N-[2-(cyclopropanecarbonylamino)ethyl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide (PubChem CID 32969083) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonylamino)ethyl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide.
| Compound Name | N-[2-(cyclopropanecarbonylamino)ethyl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 32969083 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[2-(cyclopropanecarbonylamino)ethyl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide |
| SMILES | Cc1noc(C)c1COc1cccc(C(=O)NCCNC(=O)C2CC2)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-12-17(13(2)26-22-12)11-25-16-5-3-4-15(10-16)19(24)21-9-8-20-18(23)14-6-7-14/h3-5,10,14H,6-9,11H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | LMFIHGOAVGQQEF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|