C17H21N3O5 — CID 119234883
5-[[4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]amino]pentanoic acid (PubChem CID 119234883) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 5-[[4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]amino]pentanoic acid.
| Compound Name | 5-[[4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234883 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 5-[[4-[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]benzoyl]amino]pentanoic acid |
| SMILES | CCc1nc(COc2ccc(C(=O)NCCCCC(=O)O)cc2)no1 |
| InChI | InChI=1S/C17H21N3O5/c1-2-15-19-14(20-25-15)11-24-13-8-6-12(7-9-13)17(23)18-10-4-3-5-16(21)22/h6-9H,2-5,10-11H2,1H3,(H,18,23)(H,21,22) |
| InChIKey | VCUGMYLQEXTCDX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|