C15H20N4O3S2 — CID 166422464
3-[2-[(1-ethyl-6-methylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 166422464) has the molecular formula C15H20N4O3S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-[2-[(1-ethyl-6-methylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(1-ethyl-6-methylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422464 |
| Molecular Formula | C15H20N4O3S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-[2-[(1-ethyl-6-methylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | CCn1ncc2cc(C(=O)NCCSSCCC(=O)O)c(C)nc21 |
| InChI | InChI=1S/C15H20N4O3S2/c1-3-19-14-11(9-17-19)8-12(10(2)18-14)15(22)16-5-7-24-23-6-4-13(20)21/h8-9H,3-7H2,1-2H3,(H,16,22)(H,20,21) |
| InChIKey | AVACWCRFZYFHAU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|