C17H17N5O — CID 166363312
N-[4-(aminomethyl)phenyl]-1-(4-methyl-2-pyridinyl)pyrazole-4-carboxamide (PubChem CID 166363312) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-1-(4-methyl-2-pyridinyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-(aminomethyl)phenyl]-1-(4-methyl-2-pyridinyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166363312 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-1-(4-methyl-2-pyridinyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccnc(-n2cc(C(=O)Nc3ccc(CN)cc3)cn2)c1 |
| InChI | InChI=1S/C17H17N5O/c1-12-6-7-19-16(8-12)22-11-14(10-20-22)17(23)21-15-4-2-13(9-18)3-5-15/h2-8,10-11H,9,18H2,1H3,(H,21,23) |
| InChIKey | PXGHAMQBPLTTKA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |