C18H23N3O2 — CID 143492214
4-(2-aminoethoxy)-N-[4-(aminomethyl)phenyl]-3,5-dimethylbenzamide (PubChem CID 143492214) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-N-[4-(aminomethyl)phenyl]-3,5-dimethylbenzamide.
| Compound Name | 4-(2-aminoethoxy)-N-[4-(aminomethyl)phenyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 143492214 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-(2-aminoethoxy)-N-[4-(aminomethyl)phenyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(CN)cc2)cc(C)c1OCCN |
| InChI | InChI=1S/C18H23N3O2/c1-12-9-15(10-13(2)17(12)23-8-7-19)18(22)21-16-5-3-14(11-20)4-6-16/h3-6,9-10H,7-8,11,19-20H2,1-2H3,(H,21,22) |
| InChIKey | UQUNPQHOGIYFBS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |