C18H21ClN2O3 — CID 22362448
methyl 3-[4-[[4-(aminomethyl)benzoyl]amino]phenyl]propanoate;hydrochloride (PubChem CID 22362448) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is methyl 3-[4-[[4-(aminomethyl)benzoyl]amino]phenyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[4-[[4-(aminomethyl)benzoyl]amino]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 22362448 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | methyl 3-[4-[[4-(aminomethyl)benzoyl]amino]phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)CCc1ccc(NC(=O)c2ccc(CN)cc2)cc1.Cl |
| InChI | InChI=1S/C18H20N2O3.ClH/c1-23-17(21)11-6-13-4-9-16(10-5-13)20-18(22)15-7-2-14(12-19)3-8-15;/h2-5,7-10H,6,11-12,19H2,1H3,(H,20,22);1H |
| InChIKey | YFCBRDCUAUPYKI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |