C17H16Cl3NO3 — CID 141060915
methyl 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate;hydrochloride (PubChem CID 141060915) has the molecular formula C17H16Cl3NO3 and a molecular weight of 388.68 g/mol. Its IUPAC name is methyl 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 141060915 |
| Molecular Formula | C17H16Cl3NO3 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | methyl 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)CCc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1.Cl |
| InChI | InChI=1S/C17H15Cl2NO3.ClH/c1-23-15(21)10-7-11-5-8-12(9-6-11)20-17(22)16-13(18)3-2-4-14(16)19;/h2-6,8-9H,7,10H2,1H3,(H,20,22);1H |
| InChIKey | WERMOVSYQMVQLY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |