C20H20Cl2N2O4 — CID 141067804
oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (PubChem CID 141067804) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
| Compound Name | oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 141067804 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| SMILES | O=C(CCc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1)OC1CCOCC1 |
| InChI | InChI=1S/C20H20Cl2N2O4/c21-16-11-23-12-17(22)19(16)20(26)24-14-4-1-13(2-5-14)3-6-18(25)28-15-7-9-27-10-8-15/h1-2,4-5,11-12,15H,3,6-10H2,(H,24,26) |
| InChIKey | PUVMYAQBXFNQEA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |