About oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate
oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (PubChem CID 141067804) has the molecular formula C20H20Cl2N2O4
and a molecular weight of 423.30 g/mol. Its IUPAC name is oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
Molecular Properties
| Compound Name | oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| PubChem CID | 141067804 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| SMILES | O=C(CCc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1)OC1CCOCC1 |
| InChI | InChI=1S/C20H20Cl2N2O4/c21-16-11-23-12-17(22)19(16)20(26)24-14-4-1-13(2-5-14)3-6-18(25)28-15-7-9-27-10-8-15/h1-2,4-5,11-12,15H,3,6-10H2,(H,24,26) |
| InChIKey | PUVMYAQBXFNQEA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate?
The IUPAC name of oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (CID 141067804) is oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
What is the SMILES notation for oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate?
The canonical SMILES for oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate is O=C(CCc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1)OC1CCOCC1.
What is the InChIKey of oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate?
The InChIKey is PUVMYAQBXFNQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2N2O4/c21-16-11-23-12-17(22)19(16)20(26)24-14-4-1-13(2-5-14)3-6-18(25)28-15-7-9-27-10-8-15/h1-2,4-5,11-12,15H,3,6-10H2,(H,24,26).
What are the key properties of oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate?
oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate has a molecular weight of 423.30 g/mol, XLogP of 4.30, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate is sourced from PubChem (CID 141067804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).