About oxan-4-yl 2-(4-hydroxyanilino)acetate
oxan-4-yl 2-(4-hydroxyanilino)acetate (PubChem CID 61287147) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is oxan-4-yl 2-(4-hydroxyanilino)acetate.
Molecular Properties
| Compound Name | oxan-4-yl 2-(4-hydroxyanilino)acetate |
| PubChem CID | 61287147 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | oxan-4-yl 2-(4-hydroxyanilino)acetate |
| SMILES | O=C(CNc1ccc(O)cc1)OC1CCOCC1 |
| InChI | InChI=1S/C13H17NO4/c15-11-3-1-10(2-4-11)14-9-13(16)18-12-5-7-17-8-6-12/h1-4,12,14-15H,5-9H2 |
| InChIKey | FYDWFAVHRBWDFN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze oxan-4-yl 2-(4-hydroxyanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 2-(4-hydroxyanilino)acetate?
The IUPAC name of oxan-4-yl 2-(4-hydroxyanilino)acetate (CID 61287147) is oxan-4-yl 2-(4-hydroxyanilino)acetate.
What is the SMILES notation for oxan-4-yl 2-(4-hydroxyanilino)acetate?
The canonical SMILES for oxan-4-yl 2-(4-hydroxyanilino)acetate is O=C(CNc1ccc(O)cc1)OC1CCOCC1.
What is the InChIKey of oxan-4-yl 2-(4-hydroxyanilino)acetate?
The InChIKey is FYDWFAVHRBWDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c15-11-3-1-10(2-4-11)14-9-13(16)18-12-5-7-17-8-6-12/h1-4,12,14-15H,5-9H2.
What are the key properties of oxan-4-yl 2-(4-hydroxyanilino)acetate?
oxan-4-yl 2-(4-hydroxyanilino)acetate has a molecular weight of 251.28 g/mol, XLogP of 1.53, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 2-(4-hydroxyanilino)acetate is sourced from PubChem (CID 61287147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).