About cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate
cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (PubChem CID 141067805) has the molecular formula C20H20Cl2N2O3
and a molecular weight of 407.30 g/mol. Its IUPAC name is cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
Molecular Properties
| Compound Name | cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| PubChem CID | 141067805 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| SMILES | CC(C(=O)OC1CCCC1)c1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-12(20(26)27-15-4-2-3-5-15)13-6-8-14(9-7-13)24-19(25)18-16(21)10-23-11-17(18)22/h6-12,15H,2-5H2,1H3,(H,24,25) |
| InChIKey | XROHQMINODUIIR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate?
The IUPAC name of cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (CID 141067805) is cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
What is the SMILES notation for cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate?
The canonical SMILES for cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate is CC(C(=O)OC1CCCC1)c1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1.
What is the InChIKey of cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate?
The InChIKey is XROHQMINODUIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2N2O3/c1-12(20(26)27-15-4-2-3-5-15)13-6-8-14(9-7-13)24-19(25)18-16(21)10-23-11-17(18)22/h6-12,15H,2-5H2,1H3,(H,24,25).
What are the key properties of cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate?
cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate has a molecular weight of 407.30 g/mol, XLogP of 5.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate is sourced from PubChem (CID 141067805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).