C17H16Cl2N2O3 — CID 141067849
ethyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (PubChem CID 141067849) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is ethyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
| Compound Name | ethyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 141067849 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | ethyl 2-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| SMILES | CCOC(=O)C(C)c1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-3-24-17(23)10(2)11-4-6-12(7-5-11)21-16(22)15-13(18)8-20-9-14(15)19/h4-10H,3H2,1-2H3,(H,21,22) |
| InChIKey | COJSZSQZJRUUAN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |