C22H19Cl3N4O3 — CID 87826090
ethyl 2-[(2-chloro-3-pyridinyl)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (PubChem CID 87826090) has the molecular formula C22H19Cl3N4O3 and a molecular weight of 493.78 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-3-pyridinyl)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
| Compound Name | ethyl 2-[(2-chloro-3-pyridinyl)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 87826090 |
| Molecular Formula | C22H19Cl3N4O3 |
| Molecular Weight | 493.78 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | ethyl 2-[(2-chloro-3-pyridinyl)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1)Nc1cccnc1Cl |
| InChI | InChI=1S/C22H19Cl3N4O3/c1-2-32-22(31)18(29-17-4-3-9-27-20(17)25)10-13-5-7-14(8-6-13)28-21(30)19-15(23)11-26-12-16(19)24/h3-9,11-12,18,29H,2,10H2,1H3,(H,28,30) |
| InChIKey | NDJIEUIMZYWDAB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.78 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|