C20H21Cl2N3O5 — CID 70130588
[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 70130588) has the molecular formula C20H21Cl2N3O5 and a molecular weight of 454.31 g/mol. Its IUPAC name is [4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 70130588 |
| Molecular Formula | C20H21Cl2N3O5 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | [4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)Oc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O5/c1-11(24-19(28)30-20(2,3)4)18(27)29-13-7-5-12(6-8-13)25-17(26)16-14(21)9-23-10-15(16)22/h5-11H,1-4H3,(H,24,28)(H,25,26) |
| InChIKey | GXGYKXQSUBZOEA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|