C18H27N5O5 — CID 10524617
[4-(diaminomethylideneamino)phenyl] (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate (PubChem CID 10524617) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is [4-(diaminomethylideneamino)phenyl] (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate.
| Compound Name | [4-(diaminomethylideneamino)phenyl] (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 10524617 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [4-(diaminomethylideneamino)phenyl] (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](C)C(=O)Oc1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C18H27N5O5/c1-10(22-17(26)28-18(3,4)5)14(24)21-11(2)15(25)27-13-8-6-12(7-9-13)23-16(19)20/h6-11H,1-5H3,(H,21,24)(H,22,26)(H4,19,20,23)/t10-,11-/m1/s1 |
| InChIKey | BQJSSEOHGHHMJG-GHMZBOCLSA-N |
| XLogP | 0.91 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|