C23H32N4O7S — CID 135506874
diaminomethylidene-[[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxyphenyl]methyl]azanium;4-methylbenzenesulfonate (PubChem CID 135506874) has the molecular formula C23H32N4O7S and a molecular weight of 508.60 g/mol. Its IUPAC name is diaminomethylidene-[[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxyphenyl]methyl]azanium;4-methylbenzenesulfonate.
| Compound Name | diaminomethylidene-[[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxyphenyl]methyl]azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135506874 |
| Molecular Formula | C23H32N4O7S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | diaminomethylidene-[[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxyphenyl]methyl]azanium;4-methylbenzenesulfonate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)Oc1ccc(C[NH+]=C(N)N)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H24N4O4.C7H8O3S/c1-10(20-15(22)24-16(2,3)4)13(21)23-12-7-5-11(6-8-12)9-19-14(17)18;1-6-2-4-7(5-3-6)11(8,9)10/h5-8,10H,9H2,1-4H3,(H,20,22)(H4,17,18,19);2-5H,1H3,(H,8,9,10)/t10-;/m1./s1 |
| InChIKey | MQBUGDRPQUPVJO-HNCPQSOCSA-N |
| XLogP | 0.26 |
| TPSA | 187.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|