C25H24Cl3N3O5 — CID 90984139
ethyl (2S)-2-[(2-chloro-3-oxo-7-oxaspiro[3.5]nonan-1-ylidene)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (PubChem CID 90984139) has the molecular formula C25H24Cl3N3O5 and a molecular weight of 552.84 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-chloro-3-oxo-7-oxaspiro[3.5]nonan-1-ylidene)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[(2-chloro-3-oxo-7-oxaspiro[3.5]nonan-1-ylidene)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 90984139 |
| Molecular Formula | C25H24Cl3N3O5 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | ethyl (2S)-2-[(2-chloro-3-oxo-7-oxaspiro[3.5]nonan-1-ylidene)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1)/N=C1\C(Cl)C(=O)C12CCOCC2 |
| InChI | InChI=1S/C25H24Cl3N3O5/c1-2-36-24(34)18(31-21-20(28)22(32)25(21)7-9-35-10-8-25)11-14-3-5-15(6-4-14)30-23(33)19-16(26)12-29-13-17(19)27/h3-6,12-13,18,20H,2,7-11H2,1H3,(H,30,33)/b31-21+/t18-,20?/m0/s1 |
| InChIKey | NSOMONHQCFTFGM-NEROIUNRSA-N |
| XLogP | 4.54 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|