C27H27BrCl2N4O5 — CID 91295978
ethyl (2S)-2-[(7-acetyl-2-bromo-3-oxo-7-azaspiro[3.5]nonan-1-ylidene)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate (PubChem CID 91295978) has the molecular formula C27H27BrCl2N4O5 and a molecular weight of 638.35 g/mol. Its IUPAC name is ethyl (2S)-2-[(7-acetyl-2-bromo-3-oxo-7-azaspiro[3.5]nonan-1-ylidene)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[(7-acetyl-2-bromo-3-oxo-7-azaspiro[3.5]nonan-1-ylidene)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 91295978 |
| Molecular Formula | C27H27BrCl2N4O5 |
| Molecular Weight | 638.35 g/mol |
| Exact Mass | 636.05 |
| IUPAC Name | ethyl (2S)-2-[(7-acetyl-2-bromo-3-oxo-7-azaspiro[3.5]nonan-1-ylidene)amino]-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1)/N=C1\C(Br)C(=O)C12CCN(C(C)=O)CC2 |
| InChI | InChI=1S/C27H27BrCl2N4O5/c1-3-39-26(38)20(33-23-22(28)24(36)27(23)8-10-34(11-9-27)15(2)35)12-16-4-6-17(7-5-16)32-25(37)21-18(29)13-31-14-19(21)30/h4-7,13-14,20,22H,3,8-12H2,1-2H3,(H,32,37)/b33-23+/t20-,22?/m0/s1 |
| InChIKey | VZQOIPUXUDKNSE-KZOIVPOPSA-N |
| XLogP | 4.53 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|