C22H21Cl3N4O4 — CID 91290307
ethyl (2S)-2-[(4-chloro-2,2-dimethyl-3-oxocyclobutylidene)amino]-3-[5-[(3,5-dichloropyridine-4-carbonyl)amino]-2-pyridinyl]propanoate (PubChem CID 91290307) has the molecular formula C22H21Cl3N4O4 and a molecular weight of 511.79 g/mol. Its IUPAC name is ethyl (2S)-2-[(4-chloro-2,2-dimethyl-3-oxocyclobutylidene)amino]-3-[5-[(3,5-dichloropyridine-4-carbonyl)amino]-2-pyridinyl]propanoate.
| Compound Name | ethyl (2S)-2-[(4-chloro-2,2-dimethyl-3-oxocyclobutylidene)amino]-3-[5-[(3,5-dichloropyridine-4-carbonyl)amino]-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 91290307 |
| Molecular Formula | C22H21Cl3N4O4 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | ethyl (2S)-2-[(4-chloro-2,2-dimethyl-3-oxocyclobutylidene)amino]-3-[5-[(3,5-dichloropyridine-4-carbonyl)amino]-2-pyridinyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(NC(=O)c2c(Cl)cncc2Cl)cn1)/N=C1\C(Cl)C(=O)C1(C)C |
| InChI | InChI=1S/C22H21Cl3N4O4/c1-4-33-21(32)15(29-18-17(25)19(30)22(18,2)3)7-11-5-6-12(8-27-11)28-20(31)16-13(23)9-26-10-14(16)24/h5-6,8-10,15,17H,4,7H2,1-3H3,(H,28,31)/b29-18+/t15-,17?/m0/s1 |
| InChIKey | QKUJQRHIPWHCHF-JNNMYRBGSA-N |
| XLogP | 4.17 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|