C20H14Cl4N4O4 — CID 139922702
3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(3,5-dichloro-4-pyridinyl)amino]oxypropanoic acid (PubChem CID 139922702) has the molecular formula C20H14Cl4N4O4 and a molecular weight of 516.17 g/mol. Its IUPAC name is 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(3,5-dichloro-4-pyridinyl)amino]oxypropanoic acid.
| Compound Name | 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(3,5-dichloro-4-pyridinyl)amino]oxypropanoic acid |
|---|---|
| PubChem CID | 139922702 |
| Molecular Formula | C20H14Cl4N4O4 |
| Molecular Weight | 516.17 g/mol |
| Exact Mass | 513.98 |
| IUPAC Name | 3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(3,5-dichloro-4-pyridinyl)amino]oxypropanoic acid |
| SMILES | O=C(Nc1ccc(CC(ONc2c(Cl)cncc2Cl)C(=O)O)cc1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C20H14Cl4N4O4/c21-12-6-25-7-13(22)17(12)19(29)27-11-3-1-10(2-4-11)5-16(20(30)31)32-28-18-14(23)8-26-9-15(18)24/h1-4,6-9,16H,5H2,(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | ZXNASCBJJFSDQV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.17 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|