C24H23Cl2N3O4 — CID 90774333
(2S)-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(3-oxospiro[3.5]nonan-1-ylidene)amino]propanoic acid (PubChem CID 90774333) has the molecular formula C24H23Cl2N3O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is (2S)-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(3-oxospiro[3.5]nonan-1-ylidene)amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(3-oxospiro[3.5]nonan-1-ylidene)amino]propanoic acid |
|---|---|
| PubChem CID | 90774333 |
| Molecular Formula | C24H23Cl2N3O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | (2S)-3-[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]-2-[(3-oxospiro[3.5]nonan-1-ylidene)amino]propanoic acid |
| SMILES | O=C(Nc1ccc(C[C@H](/N=C2\CC(=O)C23CCCCC3)C(=O)O)cc1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O4/c25-16-12-27-13-17(26)21(16)22(31)28-15-6-4-14(5-7-15)10-18(23(32)33)29-19-11-20(30)24(19)8-2-1-3-9-24/h4-7,12-13,18H,1-3,8-11H2,(H,28,31)(H,32,33)/b29-19+/t18-/m0/s1 |
| InChIKey | NIYFVAWLCRZKIA-FEHWFRRRSA-N |
| XLogP | 5.00 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|