C16H16ClNO3 — CID 75381688
2-chloro-N-[4-(2-hydroxyethyl)phenyl]-6-methoxybenzamide (PubChem CID 75381688) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 2-chloro-N-[4-(2-hydroxyethyl)phenyl]-6-methoxybenzamide.
| Compound Name | 2-chloro-N-[4-(2-hydroxyethyl)phenyl]-6-methoxybenzamide |
|---|---|
| PubChem CID | 75381688 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-chloro-N-[4-(2-hydroxyethyl)phenyl]-6-methoxybenzamide |
| SMILES | COc1cccc(Cl)c1C(=O)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C16H16ClNO3/c1-21-14-4-2-3-13(17)15(14)16(20)18-12-7-5-11(6-8-12)9-10-19/h2-8,19H,9-10H2,1H3,(H,18,20) |
| InChIKey | IKDKCPYBQRZOBZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |