C22H20N6O2 — CID 171358486
1-[6-(benzylamino)pyrimidin-4-yl]-N-(4-methoxyphenyl)pyrazole-4-carboxamide (PubChem CID 171358486) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 1-[6-(benzylamino)pyrimidin-4-yl]-N-(4-methoxyphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-[6-(benzylamino)pyrimidin-4-yl]-N-(4-methoxyphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171358486 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[6-(benzylamino)pyrimidin-4-yl]-N-(4-methoxyphenyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnn(-c3cc(NCc4ccccc4)ncn3)c2)cc1 |
| InChI | InChI=1S/C22H20N6O2/c1-30-19-9-7-18(8-10-19)27-22(29)17-13-26-28(14-17)21-11-20(24-15-25-21)23-12-16-5-3-2-4-6-16/h2-11,13-15H,12H2,1H3,(H,27,29)(H,23,24,25) |
| InChIKey | ZBIBXUBFABPXED-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |