C14H15N3O4 — CID 19622155
2-[4-[(4-methoxyphenyl)carbamoyl]pyrazol-1-yl]propanoic acid (PubChem CID 19622155) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)carbamoyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 2-[4-[(4-methoxyphenyl)carbamoyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 19622155 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)carbamoyl]pyrazol-1-yl]propanoic acid |
| SMILES | COc1ccc(NC(=O)c2cnn(C(C)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C14H15N3O4/c1-9(14(19)20)17-8-10(7-15-17)13(18)16-11-3-5-12(21-2)6-4-11/h3-9H,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | SBTNJSVDQMDLTA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |