C13H14N2O4S2 — CID 167831642
3-[2-(furo[3,2-b]pyridine-6-carbonylamino)ethyldisulfanyl]propanoic acid (PubChem CID 167831642) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[2-(furo[3,2-b]pyridine-6-carbonylamino)ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-(furo[3,2-b]pyridine-6-carbonylamino)ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167831642 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-[2-(furo[3,2-b]pyridine-6-carbonylamino)ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)c1cnc2ccoc2c1 |
| InChI | InChI=1S/C13H14N2O4S2/c16-12(17)2-5-20-21-6-3-14-13(18)9-7-11-10(15-8-9)1-4-19-11/h1,4,7-8H,2-3,5-6H2,(H,14,18)(H,16,17) |
| InChIKey | OBZZWIPPMWTTBI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|