C15H18N2O3S2 — CID 166422755
3-[2-[(1-methylindole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 166422755) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[2-[(1-methylindole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(1-methylindole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422755 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-[2-[(1-methylindole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | Cn1ccc2cc(C(=O)NCCSSCCC(=O)O)ccc21 |
| InChI | InChI=1S/C15H18N2O3S2/c1-17-7-4-11-10-12(2-3-13(11)17)15(20)16-6-9-22-21-8-5-14(18)19/h2-4,7,10H,5-6,8-9H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | LWJDQEXVRTUJIO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|