C12H14N2O6S2 — CID 166425203
3-[2-[(4-hydroxy-3-nitrobenzoyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 166425203) has the molecular formula C12H14N2O6S2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[2-[(4-hydroxy-3-nitrobenzoyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(4-hydroxy-3-nitrobenzoyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166425203 |
| Molecular Formula | C12H14N2O6S2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 3-[2-[(4-hydroxy-3-nitrobenzoyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O6S2/c15-10-2-1-8(7-9(10)14(19)20)12(18)13-4-6-22-21-5-3-11(16)17/h1-2,7,15H,3-6H2,(H,13,18)(H,16,17) |
| InChIKey | SEAKWLIHNMGUGV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|