C15H20N2O4S2 — CID 167984660
3-[2-[[4-(acetamidomethyl)benzoyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 167984660) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[2-[[4-(acetamidomethyl)benzoyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[4-(acetamidomethyl)benzoyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167984660 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-[2-[[4-(acetamidomethyl)benzoyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CC(=O)NCc1ccc(C(=O)NCCSSCCC(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O4S2/c1-11(18)17-10-12-2-4-13(5-3-12)15(21)16-7-9-23-22-8-6-14(19)20/h2-5H,6-10H2,1H3,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | ZUMPAAJCKRKBFF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|