C12H13FN4O — CID 19768638
N-(2-aminoethyl)-4-(4-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19768638) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-(4-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-4-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19768638 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-(2-aminoethyl)-4-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | NCCNC(=O)c1[nH]ncc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN4O/c13-9-3-1-8(2-4-9)10-7-16-17-11(10)12(18)15-6-5-14/h1-4,7H,5-6,14H2,(H,15,18)(H,16,17) |
| InChIKey | JFAWFAXGRYGHLH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |