C6H11N5O — CID 110484096
5-amino-N-(2-aminoethyl)-1H-pyrazole-4-carboxamide (PubChem CID 110484096) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is 5-amino-N-(2-aminoethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(2-aminoethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 110484096 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 5-amino-N-(2-aminoethyl)-1H-pyrazole-4-carboxamide |
| SMILES | NCCNC(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C6H11N5O/c7-1-2-9-6(12)4-3-10-11-5(4)8/h3H,1-2,7H2,(H,9,12)(H3,8,10,11) |
| InChIKey | IXUAFGDGYSYGNF-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |