C6H9ClN4O — CID 123588221
5-amino-N-(2-chloroethyl)-1H-pyrazole-4-carboxamide (PubChem CID 123588221) has the molecular formula C6H9ClN4O and a molecular weight of 188.62 g/mol. Its IUPAC name is 5-amino-N-(2-chloroethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(2-chloroethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123588221 |
| Molecular Formula | C6H9ClN4O |
| Molecular Weight | 188.62 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 5-amino-N-(2-chloroethyl)-1H-pyrazole-4-carboxamide |
| SMILES | Nc1[nH]ncc1C(=O)NCCCl |
| InChI | InChI=1S/C6H9ClN4O/c7-1-2-9-6(12)4-3-10-11-5(4)8/h3H,1-2H2,(H,9,12)(H3,8,10,11) |
| InChIKey | FDVUMGRQBCFNIS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.62 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|