C7H9F3N4OS — CID 106432190
5-amino-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrazole-4-carboxamide (PubChem CID 106432190) has the molecular formula C7H9F3N4OS and a molecular weight of 254.24 g/mol. Its IUPAC name is 5-amino-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 106432190 |
| Molecular Formula | C7H9F3N4OS |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-amino-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrazole-4-carboxamide |
| SMILES | Nc1[nH]ncc1C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C7H9F3N4OS/c8-7(9,10)16-2-1-12-6(15)4-3-13-14-5(4)11/h3H,1-2H2,(H,12,15)(H3,11,13,14) |
| InChIKey | CONOWMRHRDBXHD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|