C6H7FIN3O — CID 130614280
N-(2-fluoroethyl)-4-iodo-1H-pyrazole-5-carboxamide (PubChem CID 130614280) has the molecular formula C6H7FIN3O and a molecular weight of 283.04 g/mol. Its IUPAC name is N-(2-fluoroethyl)-4-iodo-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-fluoroethyl)-4-iodo-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 130614280 |
| Molecular Formula | C6H7FIN3O |
| Molecular Weight | 283.04 g/mol |
| Exact Mass | 282.96 |
| IUPAC Name | N-(2-fluoroethyl)-4-iodo-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCF)c1[nH]ncc1I |
| InChI | InChI=1S/C6H7FIN3O/c7-1-2-9-6(12)5-4(8)3-10-11-5/h3H,1-2H2,(H,9,12)(H,10,11) |
| InChIKey | FHTJBFZLHMEHHN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.04 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|