C16H17N3O3S2 — CID 166425025
3-[2-[(2-pyridin-4-ylpyridine-3-carbonyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 166425025) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-[2-[(2-pyridin-4-ylpyridine-3-carbonyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(2-pyridin-4-ylpyridine-3-carbonyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166425025 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-[2-[(2-pyridin-4-ylpyridine-3-carbonyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)c1cccnc1-c1ccncc1 |
| InChI | InChI=1S/C16H17N3O3S2/c20-14(21)5-10-23-24-11-9-19-16(22)13-2-1-6-18-15(13)12-3-7-17-8-4-12/h1-4,6-8H,5,9-11H2,(H,19,22)(H,20,21) |
| InChIKey | IKBXIPRTSOZDLC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|