C18H22N4O2S2 — CID 58451928
N-(2-methylsulfanylethyl)-2-[3-(2-methylsulfanylethylcarbamoyl)-2-pyridinyl]pyridine-3-carboxamide (PubChem CID 58451928) has the molecular formula C18H22N4O2S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-2-[3-(2-methylsulfanylethylcarbamoyl)-2-pyridinyl]pyridine-3-carboxamide.
| Compound Name | N-(2-methylsulfanylethyl)-2-[3-(2-methylsulfanylethylcarbamoyl)-2-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58451928 |
| Molecular Formula | C18H22N4O2S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-(2-methylsulfanylethyl)-2-[3-(2-methylsulfanylethylcarbamoyl)-2-pyridinyl]pyridine-3-carboxamide |
| SMILES | CSCCNC(=O)c1cccnc1-c1ncccc1C(=O)NCCSC |
| InChI | InChI=1S/C18H22N4O2S2/c1-25-11-9-21-17(23)13-5-3-7-19-15(13)16-14(6-4-8-20-16)18(24)22-10-12-26-2/h3-8H,9-12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | STAPSPCRZNJEFA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|