C10H13NO3S — CID 103890422
2,6-dihydroxy-N-(2-methylsulfanylethyl)benzamide (PubChem CID 103890422) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 2,6-dihydroxy-N-(2-methylsulfanylethyl)benzamide.
| Compound Name | 2,6-dihydroxy-N-(2-methylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 103890422 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2,6-dihydroxy-N-(2-methylsulfanylethyl)benzamide |
| SMILES | CSCCNC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C10H13NO3S/c1-15-6-5-11-10(14)9-7(12)3-2-4-8(9)13/h2-4,12-13H,5-6H2,1H3,(H,11,14) |
| InChIKey | DDVNAWJRGXNTJG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|