C10H11NO4 — CID 107688759
2,6-dihydroxy-N-(2-oxopropyl)benzamide (PubChem CID 107688759) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 2,6-dihydroxy-N-(2-oxopropyl)benzamide.
| Compound Name | 2,6-dihydroxy-N-(2-oxopropyl)benzamide |
|---|---|
| PubChem CID | 107688759 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2,6-dihydroxy-N-(2-oxopropyl)benzamide |
| SMILES | CC(=O)CNC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C10H11NO4/c1-6(12)5-11-10(15)9-7(13)3-2-4-8(9)14/h2-4,13-14H,5H2,1H3,(H,11,15) |
| InChIKey | FBOFWPIQKNBQGK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |