C12H17NO3S — CID 114248142
N-(3-ethylsulfanylpropyl)-2,6-dihydroxybenzamide (PubChem CID 114248142) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-(3-ethylsulfanylpropyl)-2,6-dihydroxybenzamide.
| Compound Name | N-(3-ethylsulfanylpropyl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 114248142 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(3-ethylsulfanylpropyl)-2,6-dihydroxybenzamide |
| SMILES | CCSCCCNC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C12H17NO3S/c1-2-17-8-4-7-13-12(16)11-9(14)5-3-6-10(11)15/h3,5-6,14-15H,2,4,7-8H2,1H3,(H,13,16) |
| InChIKey | LCDVYURAPYRFBJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|