C12H18N2O3S — CID 114248465
2-[2-(3-ethylsulfanylpropylcarbamoyl)pyrrol-1-yl]acetic acid (PubChem CID 114248465) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[2-(3-ethylsulfanylpropylcarbamoyl)pyrrol-1-yl]acetic acid.
| Compound Name | 2-[2-(3-ethylsulfanylpropylcarbamoyl)pyrrol-1-yl]acetic acid |
|---|---|
| PubChem CID | 114248465 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[2-(3-ethylsulfanylpropylcarbamoyl)pyrrol-1-yl]acetic acid |
| SMILES | CCSCCCNC(=O)c1cccn1CC(=O)O |
| InChI | InChI=1S/C12H18N2O3S/c1-2-18-8-4-6-13-12(17)10-5-3-7-14(10)9-11(15)16/h3,5,7H,2,4,6,8-9H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | OVLGUGJMRKYRQM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|