C14H19NO6S2 — CID 87883140
2-(3-ethylsulfanylpropylcarbamoyl)-3-methylsulfonyloxybenzoic acid (PubChem CID 87883140) has the molecular formula C14H19NO6S2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-(3-ethylsulfanylpropylcarbamoyl)-3-methylsulfonyloxybenzoic acid.
| Compound Name | 2-(3-ethylsulfanylpropylcarbamoyl)-3-methylsulfonyloxybenzoic acid |
|---|---|
| PubChem CID | 87883140 |
| Molecular Formula | C14H19NO6S2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-(3-ethylsulfanylpropylcarbamoyl)-3-methylsulfonyloxybenzoic acid |
| SMILES | CCSCCCNC(=O)c1c(OS(C)(=O)=O)cccc1C(=O)O |
| InChI | InChI=1S/C14H19NO6S2/c1-3-22-9-5-8-15-13(16)12-10(14(17)18)6-4-7-11(12)21-23(2,19)20/h4,6-7H,3,5,8-9H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | JSNAJCSCRJOAEM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|