C12H12F3NO6S2 — CID 87517449
2-(2-methylsulfanylethylcarbamoyl)-6-(trifluoromethylsulfonyloxy)benzoic acid (PubChem CID 87517449) has the molecular formula C12H12F3NO6S2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 2-(2-methylsulfanylethylcarbamoyl)-6-(trifluoromethylsulfonyloxy)benzoic acid.
| Compound Name | 2-(2-methylsulfanylethylcarbamoyl)-6-(trifluoromethylsulfonyloxy)benzoic acid |
|---|---|
| PubChem CID | 87517449 |
| Molecular Formula | C12H12F3NO6S2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 2-(2-methylsulfanylethylcarbamoyl)-6-(trifluoromethylsulfonyloxy)benzoic acid |
| SMILES | CSCCNC(=O)c1cccc(OS(=O)(=O)C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C12H12F3NO6S2/c1-23-6-5-16-10(17)7-3-2-4-8(9(7)11(18)19)22-24(20,21)12(13,14)15/h2-4H,5-6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | RFFLOCBHXMNTBK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|