C9H7F3N2O5S — CID 154454631
(2,3-dicarbamoylphenyl) trifluoromethanesulfonate (PubChem CID 154454631) has the molecular formula C9H7F3N2O5S and a molecular weight of 312.23 g/mol. Its IUPAC name is (2,3-dicarbamoylphenyl) trifluoromethanesulfonate.
| Compound Name | (2,3-dicarbamoylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154454631 |
| Molecular Formula | C9H7F3N2O5S |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | (2,3-dicarbamoylphenyl) trifluoromethanesulfonate |
| SMILES | NC(=O)c1cccc(OS(=O)(=O)C(F)(F)F)c1C(N)=O |
| InChI | InChI=1S/C9H7F3N2O5S/c10-9(11,12)20(17,18)19-5-3-1-2-4(7(13)15)6(5)8(14)16/h1-3H,(H2,13,15)(H2,14,16) |
| InChIKey | OAAMRTJOXUDGEL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|