C17H12F5NO6S — CID 87517514
3-methylsulfonyloxy-2-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoyl]benzoic acid (PubChem CID 87517514) has the molecular formula C17H12F5NO6S and a molecular weight of 453.34 g/mol. Its IUPAC name is 3-methylsulfonyloxy-2-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 3-methylsulfonyloxy-2-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 87517514 |
| Molecular Formula | C17H12F5NO6S |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 3-methylsulfonyloxy-2-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]carbamoyl]benzoic acid |
| SMILES | CS(=O)(=O)Oc1cccc(C(=O)O)c1C(=O)Nc1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F5NO6S/c1-30(27,28)29-12-4-2-3-11(15(25)26)13(12)14(24)23-10-7-5-9(6-8-10)16(18,19)17(20,21)22/h2-8H,1H3,(H,23,24)(H,25,26) |
| InChIKey | JFSOGBXOEWLCAY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|